thanks dude..
When heated, NH4COONH2 decomposes as below:
NH4COONH2(g)→2NH3 + CO2
At a certain temperature the equilibrium pressure of the system is 0.318 atm.Find the Kp for the reaction..
-
UP 0 DOWN 0 0 2

2 Answers
Asish Mahapatra
·2009-10-28 00:31:27
NH4COONH2 = 2NH3 + CO2
t=0 1 0 0
t=teq 1-a 2a a So P=1+2a=0.318(givn)
p(NH4COONH2)=(1-a)/(1+2a)
p(NH3) = 2a/(1+2a)
p(CO2)= a/(1+2a)
Kp = [CO2][NH3]2/[CH3COONH2]
which can be calculated
[] means partial pressure